About CID 176917239
CID 176917239 (PubChem CID 176917239) has the molecular formula C39H11B14N3O
and a molecular weight of 688.91 g/mol.
Molecular Properties
| Compound Name | CID 176917239 |
| PubChem CID | 176917239 |
| Molecular Formula | C39H11B14N3O |
| Molecular Weight | 688.91 g/mol |
| Exact Mass | 691.22 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2nc(-c3ccc4c(c3)oc3ccc(-c5ccccc5)cc34)nc(-c3c([B])c([B])c(-c4c([B])c([B])c([B])c([B])c4[B])c([B])c3[B])n2)c([B])c1[B] |
| InChI | InChI=1S/C39H11B14N3O/c40-23-19(20-25(42)31(48)35(52)32(49)26(20)43)24(41)28(45)21(27(23)44)38-54-37(55-39(56-38)22-29(46)33(50)36(53)34(51)30(22)47)14-6-8-15-16-10-13(12-4-2-1-3-5-12)7-9-17(16)57-18(15)11-14/h1-11H |
| InChIKey | SYEYEEVPJHVMOH-UHFFFAOYSA-N |
| XLogP | -6.78 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 688.91 |
| LogP ≤ 5 | -6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 176917239 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176917239?
The IUPAC name of CID 176917239 (CID 176917239) is not available.
What is the SMILES notation for CID 176917239?
The canonical SMILES for CID 176917239 is [B]c1c([B])c([B])c(-c2nc(-c3ccc4c(c3)oc3ccc(-c5ccccc5)cc34)nc(-c3c([B])c([B])c(-c4c([B])c([B])c([B])c([B])c4[B])c([B])c3[B])n2)c([B])c1[B].
What is the InChIKey of CID 176917239?
The InChIKey is SYEYEEVPJHVMOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H11B14N3O/c40-23-19(20-25(42)31(48)35(52)32(49)26(20)43)24(41)28(45)21(27(23)44)38-54-37(55-39(56-38)22-29(46)33(50)36(53)34(51)30(22)47)14-6-8-15-16-10-13(12-4-2-1-3-5-12)7-9-17(16)57-18(15)11-14/h1-11H.
What are the key properties of CID 176917239?
CID 176917239 has a molecular weight of 688.91 g/mol, XLogP of -6.78, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176917239 is sourced from PubChem (CID 176917239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).