About CID 174103613
CID 174103613 (PubChem CID 174103613) has the molecular formula C39H20B5N3O
and a molecular weight of 600.67 g/mol.
Molecular Properties
| Compound Name | CID 174103613 |
| PubChem CID | 174103613 |
| Molecular Formula | C39H20B5N3O |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccc5c(c4)oc4ccc(-c6ccccc6)cc45)n3)c2)c([B])c1[B] |
| InChI | InChI=1S/C39H20B5N3O/c40-32-31(33(41)35(43)36(44)34(32)42)24-12-7-13-25(18-24)38-45-37(22-10-5-2-6-11-22)46-39(47-38)26-14-16-27-28-19-23(21-8-3-1-4-9-21)15-17-29(28)48-30(27)20-26/h1-20H |
| InChIKey | PZRVNBWQPXMGLX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174103613 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174103613?
The IUPAC name of CID 174103613 (CID 174103613) is not available.
What is the SMILES notation for CID 174103613?
The canonical SMILES for CID 174103613 is [B]c1c([B])c([B])c(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccc5c(c4)oc4ccc(-c6ccccc6)cc45)n3)c2)c([B])c1[B].
What is the InChIKey of CID 174103613?
The InChIKey is PZRVNBWQPXMGLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H20B5N3O/c40-32-31(33(41)35(43)36(44)34(32)42)24-12-7-13-25(18-24)38-45-37(22-10-5-2-6-11-22)46-39(47-38)26-14-16-27-28-19-23(21-8-3-1-4-9-21)15-17-29(28)48-30(27)20-26/h1-20H.
What are the key properties of CID 174103613?
CID 174103613 has a molecular weight of 600.67 g/mol, XLogP of 4.07, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174103613 is sourced from PubChem (CID 174103613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).