C45H24B5N3O — CID 174072242
CID 174072242 (PubChem CID 174072242) has the molecular formula C45H24B5N3O and a molecular weight of 676.77 g/mol.
| Compound Name | CID 174072242 |
|---|---|
| PubChem CID | 174072242 |
| Molecular Formula | C45H24B5N3O |
| Molecular Weight | 676.77 g/mol |
| Exact Mass | 677.24 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2ccc(-c3ccc4oc5cccc(-c6nc(-c7ccccc7)nc(-c7ccc(-c8ccccc8)cc7)n6)c5c4c3)cc2)c([B])c1[B] |
| InChI | InChI=1S/C45H24B5N3O/c46-38-36(39(47)41(49)42(50)40(38)48)28-18-14-27(15-19-28)31-22-23-34-33(24-31)37-32(12-7-13-35(37)54-34)45-52-43(29-10-5-2-6-11-29)51-44(53-45)30-20-16-26(17-21-30)25-8-3-1-4-9-25/h1-24H |
| InChIKey | JNYKXZKDVXRBAO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.77 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|