C34H23N3O — CID 134199083
2-[8-(4-methylphenyl)dibenzofuran-1-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 134199083) has the molecular formula C34H23N3O and a molecular weight of 489.58 g/mol. Its IUPAC name is 2-[8-(4-methylphenyl)dibenzofuran-1-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[8-(4-methylphenyl)dibenzofuran-1-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 134199083 |
| Molecular Formula | C34H23N3O |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 2-[8-(4-methylphenyl)dibenzofuran-1-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1ccc(-c2ccc3oc4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4c3c2)cc1 |
| InChI | InChI=1S/C34H23N3O/c1-22-15-17-23(18-16-22)26-19-20-29-28(21-26)31-27(13-8-14-30(31)38-29)34-36-32(24-9-4-2-5-10-24)35-33(37-34)25-11-6-3-7-12-25/h2-21H,1H3 |
| InChIKey | NQDOABNXUHAIDN-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |