C62H47N3S — CID 145291891
CID 145291891 (PubChem CID 145291891) has the molecular formula C62H47N3S and a molecular weight of 866.15 g/mol.
| Compound Name | CID 145291891 |
|---|---|
| PubChem CID | 145291891 |
| Molecular Formula | C62H47N3S |
| Molecular Weight | 866.15 g/mol |
| Exact Mass | 865.35 |
| IUPAC Name | — |
| SMILES | C=N/C(=N\C(=N/Cc1ccc2c(c1)C1(c3ccccc3C3(c4ccccc4-c4ccccc43)c3ccccc31)c1c-2ccc2c1S/C=C\C=C/C2=C)c1ccccc1)c1ccccc1.CC |
| InChI | InChI=1S/C60H41N3S.C2H6/c1-39-19-17-18-36-64-56-43(39)34-35-47-46-33-32-40(38-62-58(42-22-7-4-8-23-42)63-57(61-2)41-20-5-3-6-21-41)37-54(46)60(55(47)56)52-30-15-13-28-50(52)59(51-29-14-16-31-53(51)60)48-26-11-9-24-44(48)45-25-10-12-27-49(45)59;1-2/h3-37H,1-2,38H2;1-2H3/b19-17-,36-18-,62-58-,63-57-; |
| InChIKey | CGUCMFKAJPPSHS-BDEZHYEKSA-N |
| XLogP | 15.04 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.15 |
| LogP ≤ 5 | 15.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|