C30H27N3 — CID 144953404
N'-[C-cyclohexa-1,5-dien-1-yl-N-[(6-methyl-9H-fluoren-1-yl)methyl]carbonimidoyl]-N-methylidenebenzenecarboximidamide (PubChem CID 144953404) has the molecular formula C30H27N3 and a molecular weight of 429.57 g/mol. Its IUPAC name is N'-[C-cyclohexa-1,5-dien-1-yl-N-[(6-methyl-9H-fluoren-1-yl)methyl]carbonimidoyl]-N-methylidenebenzenecarboximidamide.
| Compound Name | N'-[C-cyclohexa-1,5-dien-1-yl-N-[(6-methyl-9H-fluoren-1-yl)methyl]carbonimidoyl]-N-methylidenebenzenecarboximidamide |
|---|---|
| PubChem CID | 144953404 |
| Molecular Formula | C30H27N3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N'-[C-cyclohexa-1,5-dien-1-yl-N-[(6-methyl-9H-fluoren-1-yl)methyl]carbonimidoyl]-N-methylidenebenzenecarboximidamide |
| SMILES | C=N/C(=N\C(=N/Cc1cccc2c1Cc1ccc(C)cc1-2)C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C30H27N3/c1-21-16-17-24-19-28-25(14-9-15-26(28)27(24)18-21)20-32-30(23-12-7-4-8-13-23)33-29(31-2)22-10-5-3-6-11-22/h3,5-7,9-18H,2,4,8,19-20H2,1H3/b32-30-,33-29- |
| InChIKey | LVDXCRBFIKIJCK-UHLGJUBNSA-N |
| XLogP | 6.89 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|