C30H24N2 — CID 145108666
N-methylidene-6-(4-methylphenyl)-N'-(1-phenylethenyl)-9H-fluorene-3-carboximidamide (PubChem CID 145108666) has the molecular formula C30H24N2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-methylidene-6-(4-methylphenyl)-N'-(1-phenylethenyl)-9H-fluorene-3-carboximidamide.
| Compound Name | N-methylidene-6-(4-methylphenyl)-N'-(1-phenylethenyl)-9H-fluorene-3-carboximidamide |
|---|---|
| PubChem CID | 145108666 |
| Molecular Formula | C30H24N2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-methylidene-6-(4-methylphenyl)-N'-(1-phenylethenyl)-9H-fluorene-3-carboximidamide |
| SMILES | C=N/C(=N\C(=C)c1ccccc1)c1ccc2c(c1)-c1cc(-c3ccc(C)cc3)ccc1C2 |
| InChI | InChI=1S/C30H24N2/c1-20-9-11-23(12-10-20)24-13-14-25-17-26-15-16-27(19-29(26)28(25)18-24)30(31-3)32-21(2)22-7-5-4-6-8-22/h4-16,18-19H,2-3,17H2,1H3/b32-30- |
| InChIKey | AHQNZKJZGVCZEE-GCUVURNUSA-N |
| XLogP | 7.35 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|