C33H29N — CID 142394381
1-[3-[3-[(3E)-penta-1,3-dien-3-yl]phenyl]phenyl]-N-[1-(4-phenylphenyl)ethenyl]ethanimine (PubChem CID 142394381) has the molecular formula C33H29N and a molecular weight of 439.60 g/mol. Its IUPAC name is 1-[3-[3-[(3E)-penta-1,3-dien-3-yl]phenyl]phenyl]-N-[1-(4-phenylphenyl)ethenyl]ethanimine.
| Compound Name | 1-[3-[3-[(3E)-penta-1,3-dien-3-yl]phenyl]phenyl]-N-[1-(4-phenylphenyl)ethenyl]ethanimine |
|---|---|
| PubChem CID | 142394381 |
| Molecular Formula | C33H29N |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 1-[3-[3-[(3E)-penta-1,3-dien-3-yl]phenyl]phenyl]-N-[1-(4-phenylphenyl)ethenyl]ethanimine |
| SMILES | C=C/C(=C\C)c1cccc(-c2cccc(/C(C)=N/C(=C)c3ccc(-c4ccccc4)cc3)c2)c1 |
| InChI | InChI=1S/C33H29N/c1-5-26(6-2)31-15-11-17-33(23-31)32-16-10-14-30(22-32)25(4)34-24(3)27-18-20-29(21-19-27)28-12-8-7-9-13-28/h5-23H,1,3H2,2,4H3/b26-6+,34-25+ |
| InChIKey | QNQTXUZSHPUPBQ-SCBSWZKMSA-N |
| XLogP | 9.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|