C31H28N2 — CID 155691013
N'-[1-[3-(3,4-dimethylphenyl)phenyl]ethenyl]-N-(1-phenylethylidene)benzenecarboximidamide (PubChem CID 155691013) has the molecular formula C31H28N2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N'-[1-[3-(3,4-dimethylphenyl)phenyl]ethenyl]-N-(1-phenylethylidene)benzenecarboximidamide.
| Compound Name | N'-[1-[3-(3,4-dimethylphenyl)phenyl]ethenyl]-N-(1-phenylethylidene)benzenecarboximidamide |
|---|---|
| PubChem CID | 155691013 |
| Molecular Formula | C31H28N2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N'-[1-[3-(3,4-dimethylphenyl)phenyl]ethenyl]-N-(1-phenylethylidene)benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1ccccc1)c1ccccc1)c1cccc(-c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C31H28N2/c1-22-18-19-30(20-23(22)2)29-17-11-16-28(21-29)25(4)33-31(27-14-9-6-10-15-27)32-24(3)26-12-7-5-8-13-26/h5-21H,4H2,1-3H3/b32-24+,33-31- |
| InChIKey | GYJFNWDTOOHMQO-VUTRVNCBSA-N |
| XLogP | 7.90 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|