About 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane
1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane (PubChem CID 144938526) has the molecular formula C19H22
and a molecular weight of 250.38 g/mol. Its IUPAC name is 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane.
Molecular Properties
| Compound Name | 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane |
| PubChem CID | 144938526 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane |
| SMILES | C.C/C=C\C(=C/C)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H18.CH4/c1-3-9-15(4-2)17-12-8-13-18(14-17)16-10-6-5-7-11-16;/h3-14H,1-2H3;1H4/b9-3-,15-4+; |
| InChIKey | PHTMTPVXDNJPQQ-MUQZJOHJSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane?
The IUPAC name of 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane (CID 144938526) is 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane.
What is the SMILES notation for 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane?
The canonical SMILES for 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane is C.C/C=C\C(=C/C)c1cccc(-c2ccccc2)c1.
What is the InChIKey of 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane?
The InChIKey is PHTMTPVXDNJPQQ-MUQZJOHJSA-N. The full InChI is InChI=1S/C18H18.CH4/c1-3-9-15(4-2)17-12-8-13-18(14-17)16-10-6-5-7-11-16;/h3-14H,1-2H3;1H4/b9-3-,15-4+;.
What are the key properties of 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane?
1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane has a molecular weight of 250.38 g/mol, XLogP of 5.97, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-phenylbenzene;methane is sourced from PubChem (CID 144938526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).