C38H37N — CID 145390494
ethane;N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-4-phenyl-N-(4-phenylphenyl)aniline (PubChem CID 145390494) has the molecular formula C38H37N and a molecular weight of 507.72 g/mol. Its IUPAC name is ethane;N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-4-phenyl-N-(4-phenylphenyl)aniline.
| Compound Name | ethane;N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-4-phenyl-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 145390494 |
| Molecular Formula | C38H37N |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | ethane;N-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]-4-phenyl-N-(4-phenylphenyl)aniline |
| SMILES | C/C=C\C(=C/C)c1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)cc1.CC |
| InChI | InChI=1S/C36H31N.C2H6/c1-3-11-28(4-2)31-16-22-34(23-17-31)37(35-24-18-32(19-25-35)29-12-7-5-8-13-29)36-26-20-33(21-27-36)30-14-9-6-10-15-30;1-2/h3-27H,1-2H3;1-2H3/b11-3-,28-4+; |
| InChIKey | JBBYBANRNOQBQU-JGPSXSPJSA-N |
| XLogP | 11.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|