C32H29N — CID 143445033
N-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-4-methyl-N-(4-phenylphenyl)aniline (PubChem CID 143445033) has the molecular formula C32H29N and a molecular weight of 427.59 g/mol. Its IUPAC name is N-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-4-methyl-N-(4-phenylphenyl)aniline.
| Compound Name | N-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-4-methyl-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 143445033 |
| Molecular Formula | C32H29N |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-[4-[(2E,4Z)-hepta-2,4,6-trien-3-yl]phenyl]-4-methyl-N-(4-phenylphenyl)aniline |
| SMILES | C=C/C=C\C(=C/C)c1ccc(N(c2ccc(C)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H29N/c1-4-6-10-26(5-2)28-15-21-31(22-16-28)33(30-19-13-25(3)14-20-30)32-23-17-29(18-24-32)27-11-8-7-9-12-27/h4-24H,1H2,2-3H3/b10-6-,26-5+ |
| InChIKey | RYKBEDBIUAIQCS-LZBMQSCMSA-N |
| XLogP | 9.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|