C37H34 — CID 143388590
1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]-5-phenylbenzene (PubChem CID 143388590) has the molecular formula C37H34 and a molecular weight of 478.68 g/mol. Its IUPAC name is 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]-5-phenylbenzene.
| Compound Name | 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]-5-phenylbenzene |
|---|---|
| PubChem CID | 143388590 |
| Molecular Formula | C37H34 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]-5-phenylbenzene |
| SMILES | C=C/C=C\C(=C/C)c1cc(-c2ccccc2)cc(-c2cc(C(/C=C\C)=C/C)cc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C37H34/c1-5-9-17-29(8-4)33-23-35(31-20-14-11-15-21-31)27-37(25-33)36-24-32(28(7-3)16-6-2)22-34(26-36)30-18-12-10-13-19-30/h5-27H,1H2,2-4H3/b16-6-,17-9-,28-7+,29-8+ |
| InChIKey | CKKYOGGRHLYDES-QMFGXPDBSA-N |
| XLogP | 10.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|