C21H23N — CID 144892717
1-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]-N-methylethenamine (PubChem CID 144892717) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]-N-methylethenamine.
| Compound Name | 1-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]-N-methylethenamine |
|---|---|
| PubChem CID | 144892717 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]-N-methylethenamine |
| SMILES | C=C(NC)c1cc(C(/C=C\C)=C/C)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H23N/c1-5-10-17(6-2)20-13-19(16(3)22-4)14-21(15-20)18-11-8-7-9-12-18/h5-15,22H,3H2,1-2,4H3/b10-5-,17-6+ |
| InChIKey | MFPGYWBLPPPDCY-NJXWOGOQSA-N |
| XLogP | 5.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|