C38H35N3 — CID 143239809
acetylene;3-[4-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]-6-[3-(methylamino)phenyl]-2-pyridinyl]aniline (PubChem CID 143239809) has the molecular formula C38H35N3 and a molecular weight of 533.72 g/mol. Its IUPAC name is acetylene;3-[4-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]-6-[3-(methylamino)phenyl]-2-pyridinyl]aniline.
| Compound Name | acetylene;3-[4-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]-6-[3-(methylamino)phenyl]-2-pyridinyl]aniline |
|---|---|
| PubChem CID | 143239809 |
| Molecular Formula | C38H35N3 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | acetylene;3-[4-[3-[(2E,4Z)-hexa-2,4-dien-3-yl]-5-phenylphenyl]-6-[3-(methylamino)phenyl]-2-pyridinyl]aniline |
| SMILES | C#C.C/C=C\C(=C/C)c1cc(-c2ccccc2)cc(-c2cc(-c3cccc(N)c3)nc(-c3cccc(NC)c3)c2)c1 |
| InChI | InChI=1S/C36H33N3.C2H2/c1-4-11-25(5-2)29-18-30(26-12-7-6-8-13-26)20-31(19-29)32-23-35(27-14-9-16-33(37)21-27)39-36(24-32)28-15-10-17-34(22-28)38-3;1-2/h4-24,38H,37H2,1-3H3;1-2H/b11-4-,25-5+; |
| InChIKey | SPKGJLGXESZNNC-JTFXKNGRSA-N |
| XLogP | 9.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|