C25H26N6 — CID 143240013
5-[6-[3,5-bis(methylamino)phenyl]-2-phenylpyrimidin-4-yl]-3-N-methylbenzene-1,3-diamine (PubChem CID 143240013) has the molecular formula C25H26N6 and a molecular weight of 410.53 g/mol. Its IUPAC name is 5-[6-[3,5-bis(methylamino)phenyl]-2-phenylpyrimidin-4-yl]-3-N-methylbenzene-1,3-diamine.
| Compound Name | 5-[6-[3,5-bis(methylamino)phenyl]-2-phenylpyrimidin-4-yl]-3-N-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 143240013 |
| Molecular Formula | C25H26N6 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 5-[6-[3,5-bis(methylamino)phenyl]-2-phenylpyrimidin-4-yl]-3-N-methylbenzene-1,3-diamine |
| SMILES | CNc1cc(N)cc(-c2cc(-c3cc(NC)cc(NC)c3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C25H26N6/c1-27-20-10-17(9-19(26)13-20)23-15-24(18-11-21(28-2)14-22(12-18)29-3)31-25(30-23)16-7-5-4-6-8-16/h4-15,27-29H,26H2,1-3H3 |
| InChIKey | WZGPKYFIKFNETR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|