About N-methylazulen-2-amine
N-methylazulen-2-amine (PubChem CID 175045574) has the molecular formula C11H11N
and a molecular weight of 157.22 g/mol. Its IUPAC name is N-methylazulen-2-amine.
Molecular Properties
| Compound Name | N-methylazulen-2-amine |
| PubChem CID | 175045574 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | N-methylazulen-2-amine |
| SMILES | CNc1cc2cccccc-2c1 |
| InChI | InChI=1S/C11H11N/c1-12-11-7-9-5-3-2-4-6-10(9)8-11/h2-8,12H,1H3 |
| InChIKey | IKEVZUASXKKLQG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methylazulen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylazulen-2-amine?
The IUPAC name of N-methylazulen-2-amine (CID 175045574) is N-methylazulen-2-amine.
What is the SMILES notation for N-methylazulen-2-amine?
The canonical SMILES for N-methylazulen-2-amine is CNc1cc2cccccc-2c1.
What is the InChIKey of N-methylazulen-2-amine?
The InChIKey is IKEVZUASXKKLQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N/c1-12-11-7-9-5-3-2-4-6-10(9)8-11/h2-8,12H,1H3.
What are the key properties of N-methylazulen-2-amine?
N-methylazulen-2-amine has a molecular weight of 157.22 g/mol, XLogP of 2.83, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylazulen-2-amine is sourced from PubChem (CID 175045574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).