C36H30N4 — CID 143239958
N-methyl-4-[3-[6-[3-[4-(methylamino)phenyl]phenyl]-2-phenylpyrimidin-4-yl]phenyl]aniline (PubChem CID 143239958) has the molecular formula C36H30N4 and a molecular weight of 518.66 g/mol. Its IUPAC name is N-methyl-4-[3-[6-[3-[4-(methylamino)phenyl]phenyl]-2-phenylpyrimidin-4-yl]phenyl]aniline.
| Compound Name | N-methyl-4-[3-[6-[3-[4-(methylamino)phenyl]phenyl]-2-phenylpyrimidin-4-yl]phenyl]aniline |
|---|---|
| PubChem CID | 143239958 |
| Molecular Formula | C36H30N4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | N-methyl-4-[3-[6-[3-[4-(methylamino)phenyl]phenyl]-2-phenylpyrimidin-4-yl]phenyl]aniline |
| SMILES | CNc1ccc(-c2cccc(-c3cc(-c4cccc(-c5ccc(NC)cc5)c4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C36H30N4/c1-37-32-18-14-25(15-19-32)28-10-6-12-30(22-28)34-24-35(40-36(39-34)27-8-4-3-5-9-27)31-13-7-11-29(23-31)26-16-20-33(38-2)21-17-26/h3-24,37-38H,1-2H3 |
| InChIKey | AZRSVPICVCDMGV-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |