C24H23N5 — CID 143239907
3-[4,6-bis[3-(methylamino)phenyl]pyrimidin-2-yl]aniline (PubChem CID 143239907) has the molecular formula C24H23N5 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[4,6-bis[3-(methylamino)phenyl]pyrimidin-2-yl]aniline.
| Compound Name | 3-[4,6-bis[3-(methylamino)phenyl]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 143239907 |
| Molecular Formula | C24H23N5 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 3-[4,6-bis[3-(methylamino)phenyl]pyrimidin-2-yl]aniline |
| SMILES | CNc1cccc(-c2cc(-c3cccc(NC)c3)nc(-c3cccc(N)c3)n2)c1 |
| InChI | InChI=1S/C24H23N5/c1-26-20-10-4-6-16(13-20)22-15-23(17-7-5-11-21(14-17)27-2)29-24(28-22)18-8-3-9-19(25)12-18/h3-15,26-27H,25H2,1-2H3 |
| InChIKey | XHOJRTLEMHJREE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|