C10H10N4 — CID 82468537
N-methyl-3-(1,3,5-triazin-2-yl)aniline (PubChem CID 82468537) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is N-methyl-3-(1,3,5-triazin-2-yl)aniline.
| Compound Name | N-methyl-3-(1,3,5-triazin-2-yl)aniline |
|---|---|
| PubChem CID | 82468537 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | N-methyl-3-(1,3,5-triazin-2-yl)aniline |
| SMILES | CNc1cccc(-c2ncncn2)c1 |
| InChI | InChI=1S/C10H10N4/c1-11-9-4-2-3-8(5-9)10-13-6-12-7-14-10/h2-7,11H,1H3 |
| InChIKey | GSVPLCFBGLUNQW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |