C41H31N3 — CID 143332124
3-[6-(3-aminophenyl)-4-[4-(3,5-diphenylphenyl)phenyl]-2-pyridinyl]aniline (PubChem CID 143332124) has the molecular formula C41H31N3 and a molecular weight of 565.72 g/mol. Its IUPAC name is 3-[6-(3-aminophenyl)-4-[4-(3,5-diphenylphenyl)phenyl]-2-pyridinyl]aniline.
| Compound Name | 3-[6-(3-aminophenyl)-4-[4-(3,5-diphenylphenyl)phenyl]-2-pyridinyl]aniline |
|---|---|
| PubChem CID | 143332124 |
| Molecular Formula | C41H31N3 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | 3-[6-(3-aminophenyl)-4-[4-(3,5-diphenylphenyl)phenyl]-2-pyridinyl]aniline |
| SMILES | Nc1cccc(-c2cc(-c3ccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)cc3)cc(-c3cccc(N)c3)n2)c1 |
| InChI | InChI=1S/C41H31N3/c42-38-15-7-13-32(24-38)40-26-37(27-41(44-40)33-14-8-16-39(43)25-33)31-19-17-30(18-20-31)36-22-34(28-9-3-1-4-10-28)21-35(23-36)29-11-5-2-6-12-29/h1-27H,42-43H2 |
| InChIKey | HBTWURVCLXZQGW-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|