C46H39N5 — CID 144772412
2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-phenylphenyl)phenyl]-6-[(2Z,4E)-hepta-2,4-dien-4-yl]-N-methylpyridin-4-amine (PubChem CID 144772412) has the molecular formula C46H39N5 and a molecular weight of 661.85 g/mol. Its IUPAC name is 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-phenylphenyl)phenyl]-6-[(2Z,4E)-hepta-2,4-dien-4-yl]-N-methylpyridin-4-amine.
| Compound Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-phenylphenyl)phenyl]-6-[(2Z,4E)-hepta-2,4-dien-4-yl]-N-methylpyridin-4-amine |
|---|---|
| PubChem CID | 144772412 |
| Molecular Formula | C46H39N5 |
| Molecular Weight | 661.85 g/mol |
| Exact Mass | 661.32 |
| IUPAC Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-(4-phenylphenyl)phenyl]-6-[(2Z,4E)-hepta-2,4-dien-4-yl]-N-methylpyridin-4-amine |
| SMILES | C/C=C\C(=C/CC)c1cc(NC)cc(-c2cc(-c3ccc(-c4ccccc4)cc3)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)n1 |
| InChI | InChI=1S/C46H39N5/c1-4-15-35(16-5-2)42-30-41(47-3)31-43(48-42)39-27-38(34-25-23-33(24-26-34)32-17-9-6-10-18-32)28-40(29-39)46-50-44(36-19-11-7-12-20-36)49-45(51-46)37-21-13-8-14-22-37/h4,6-31H,5H2,1-3H3,(H,47,48)/b15-4-,35-16+ |
| InChIKey | ILDBEJGIGZKSJW-UAYDGTQSSA-N |
| XLogP | 11.68 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.85 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|