C40H45N3 — CID 145452765
ethane;2-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]-4-(3-methylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine;propane (PubChem CID 145452765) has the molecular formula C40H45N3 and a molecular weight of 567.82 g/mol. Its IUPAC name is ethane;2-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]-4-(3-methylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine;propane.
| Compound Name | ethane;2-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]-4-(3-methylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine;propane |
|---|---|
| PubChem CID | 145452765 |
| Molecular Formula | C40H45N3 |
| Molecular Weight | 567.82 g/mol |
| Exact Mass | 567.36 |
| IUPAC Name | ethane;2-[4-[(2Z,4E)-hepta-2,4-dien-4-yl]phenyl]-4-(3-methylphenyl)-6-(4-phenylphenyl)-1,3,5-triazine;propane |
| SMILES | C/C=C\C(=C/CC)c1ccc(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3cccc(C)c3)n2)cc1.CC.CCC |
| InChI | InChI=1S/C35H31N3.C3H8.C2H6/c1-4-10-26(11-5-2)28-16-20-30(21-17-28)33-36-34(38-35(37-33)32-15-9-12-25(3)24-32)31-22-18-29(19-23-31)27-13-7-6-8-14-27;1-3-2;1-2/h4,6-24H,5H2,1-3H3;3H2,1-2H3;1-2H3/b10-4-,26-11+;; |
| InChIKey | LCUGEBQCAXFOCE-YHFHJZGASA-N |
| XLogP | 11.66 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.82 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|