C26H23N3 — CID 143444775
2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-(6-methylnaphthalen-2-yl)-6-phenyl-1,3,5-triazine (PubChem CID 143444775) has the molecular formula C26H23N3 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-(6-methylnaphthalen-2-yl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-(6-methylnaphthalen-2-yl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 143444775 |
| Molecular Formula | C26H23N3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-(6-methylnaphthalen-2-yl)-6-phenyl-1,3,5-triazine |
| SMILES | C/C=C\C(=C/C)c1nc(-c2ccccc2)nc(-c2ccc3cc(C)ccc3c2)n1 |
| InChI | InChI=1S/C26H23N3/c1-4-9-19(5-2)24-27-25(20-10-7-6-8-11-20)29-26(28-24)23-15-14-21-16-18(3)12-13-22(21)17-23/h4-17H,1-3H3/b9-4-,19-5+ |
| InChIKey | RUSFHKLLFUMRPZ-WTFVYTDDSA-N |
| XLogP | 6.65 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|