C25H27N3 — CID 135197445
2-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-6-phenyl-1,3,5-triazine (PubChem CID 135197445) has the molecular formula C25H27N3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 135197445 |
| Molecular Formula | C25H27N3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 2-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]-4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-6-phenyl-1,3,5-triazine |
| SMILES | C/C=C\C=C/C(=C\C)c1nc(C(/C=C\C)=C/C=C\C)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H27N3/c1-5-9-12-17-20(8-4)23-26-24(21(15-7-3)16-10-6-2)28-25(27-23)22-18-13-11-14-19-22/h5-19H,1-4H3/b9-5-,10-6-,15-7-,17-12-,20-8+,21-16+ |
| InChIKey | KDOOVUNYINPPQS-REUQIQQWSA-N |
| XLogP | 6.61 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|