C23H24BrN3 — CID 145257402
2-(4-bromophenyl)-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazine;ethane (PubChem CID 145257402) has the molecular formula C23H24BrN3 and a molecular weight of 422.37 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazine;ethane.
| Compound Name | 2-(4-bromophenyl)-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazine;ethane |
|---|---|
| PubChem CID | 145257402 |
| Molecular Formula | C23H24BrN3 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-(4-bromophenyl)-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenyl-1,3,5-triazine;ethane |
| SMILES | C/C=C\C(=C/C)c1nc(-c2ccccc2)nc(-c2ccc(Br)cc2)n1.CC |
| InChI | InChI=1S/C21H18BrN3.C2H6/c1-3-8-15(4-2)19-23-20(16-9-6-5-7-10-16)25-21(24-19)17-11-13-18(22)14-12-17;1-2/h3-14H,1-2H3;1-2H3/b8-3-,15-4+; |
| InChIKey | URAOPXBUXTYCLV-PZSDFLJMSA-N |
| XLogP | 6.97 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|