C26H23N5 — CID 144875855
2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]-6-phenyl-1,3,5-triazine (PubChem CID 144875855) has the molecular formula C26H23N5 and a molecular weight of 405.51 g/mol. Its IUPAC name is 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 144875855 |
| Molecular Formula | C26H23N5 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]-6-phenyl-1,3,5-triazine |
| SMILES | C/C=C\C(=C/C)c1nc(-c2ccccc2)nc(-c2ccnc(-c3cc(C)ccn3)c2)n1 |
| InChI | InChI=1S/C26H23N5/c1-4-9-19(5-2)24-29-25(20-10-7-6-8-11-20)31-26(30-24)21-13-15-28-23(17-21)22-16-18(3)12-14-27-22/h4-17H,1-3H3/b9-4-,19-5+ |
| InChIKey | BODAQWVIDNYIST-WTFVYTDDSA-N |
| XLogP | 5.95 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|