C58H42N6 — CID 121257999
2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-phenyl-6-[4-[6-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-1-yl]phenyl]-1,3,5-triazine (PubChem CID 121257999) has the molecular formula C58H42N6 and a molecular weight of 823.02 g/mol. Its IUPAC name is 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-phenyl-6-[4-[6-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-1-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-phenyl-6-[4-[6-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-1-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 121257999 |
| Molecular Formula | C58H42N6 |
| Molecular Weight | 823.02 g/mol |
| Exact Mass | 822.35 |
| IUPAC Name | 2-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-phenyl-6-[4-[6-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-1-yl]phenyl]-1,3,5-triazine |
| SMILES | C/C=C\C(=C/C)c1nc(-c2ccccc2)nc(-c2ccc(-c3cccc4cc(-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccc(-c8ccccc8)cc7)n6)cc5)ccc34)cc2)n1 |
| InChI | InChI=1S/C58H42N6/c1-3-15-39(4-2)53-59-54(44-18-10-6-11-19-44)61-56(60-53)48-34-28-43(29-35-48)51-23-14-22-50-38-49(36-37-52(50)51)42-26-32-47(33-27-42)58-63-55(45-20-12-7-13-21-45)62-57(64-58)46-30-24-41(25-31-46)40-16-8-5-9-17-40/h3-38H,1-2H3/b15-3-,39-4+ |
| InChIKey | SBZQKFYQMQWKML-DAKQDJPQSA-N |
| XLogP | 14.53 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.02 |
| LogP ≤ 5 | 14.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|