C53H42N2 — CID 121257964
2-[4-[6-[3-(9,9-dimethylfluoren-2-yl)phenyl]naphthalen-1-yl]phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenylpyrimidine (PubChem CID 121257964) has the molecular formula C53H42N2 and a molecular weight of 706.93 g/mol. Its IUPAC name is 2-[4-[6-[3-(9,9-dimethylfluoren-2-yl)phenyl]naphthalen-1-yl]phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenylpyrimidine.
| Compound Name | 2-[4-[6-[3-(9,9-dimethylfluoren-2-yl)phenyl]naphthalen-1-yl]phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenylpyrimidine |
|---|---|
| PubChem CID | 121257964 |
| Molecular Formula | C53H42N2 |
| Molecular Weight | 706.93 g/mol |
| Exact Mass | 706.33 |
| IUPAC Name | 2-[4-[6-[3-(9,9-dimethylfluoren-2-yl)phenyl]naphthalen-1-yl]phenyl]-4-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-phenylpyrimidine |
| SMILES | C/C=C\C(=C/C)c1cc(-c2ccccc2)nc(-c2ccc(-c3cccc4cc(-c5cccc(-c6ccc7c(c6)C(C)(C)c6ccccc6-7)c5)ccc34)cc2)n1 |
| InChI | InChI=1S/C53H42N2/c1-5-14-35(6-2)50-34-51(37-15-8-7-9-16-37)55-52(54-50)38-25-23-36(24-26-38)44-21-13-19-43-32-41(27-29-45(43)44)39-17-12-18-40(31-39)42-28-30-47-46-20-10-11-22-48(46)53(3,4)49(47)33-42/h5-34H,1-4H3/b14-5-,35-6+ |
| InChIKey | LPDJOKNWXILQPZ-HDTHEZSMSA-N |
| XLogP | 14.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.93 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|