C41H35N3 — CID 146384885
2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[2-(4-naphthalen-1-ylphenyl)propan-2-yl]phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 146384885) has the molecular formula C41H35N3 and a molecular weight of 569.75 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[2-(4-naphthalen-1-ylphenyl)propan-2-yl]phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[2-(4-naphthalen-1-ylphenyl)propan-2-yl]phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 146384885 |
| Molecular Formula | C41H35N3 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[2-(4-naphthalen-1-ylphenyl)propan-2-yl]phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C/C)c1nc(-c2ccccc2)nc(-c2ccc(C(C)(C)c3ccc(-c4cccc5ccccc45)cc3)cc2)n1 |
| InChI | InChI=1S/C41H35N3/c1-5-13-31(14-6-2)38-42-39(32-16-8-7-9-17-32)44-40(43-38)33-23-27-35(28-24-33)41(3,4)34-25-21-30(22-26-34)37-20-12-18-29-15-10-11-19-36(29)37/h5-28H,1H2,2-4H3/b14-6-,31-13+ |
| InChIKey | LRIBAOGDVIYKCJ-CZJJPZLOSA-N |
| XLogP | 10.50 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|