C41H29N3 — CID 144979795
2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-phenyl-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine (PubChem CID 144979795) has the molecular formula C41H29N3 and a molecular weight of 563.70 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-phenyl-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-phenyl-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 144979795 |
| Molecular Formula | C41H29N3 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-phenyl-6-(9,9'-spirobi[fluorene]-2-yl)-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C/C)c1nc(-c2ccccc2)nc(-c2ccc3c(c2)C2(c4ccccc4-c4ccccc42)c2ccccc2-3)n1 |
| InChI | InChI=1S/C41H29N3/c1-3-14-27(15-4-2)38-42-39(28-16-6-5-7-17-28)44-40(43-38)29-24-25-33-32-20-10-13-23-36(32)41(37(33)26-29)34-21-11-8-18-30(34)31-19-9-12-22-35(31)41/h3-26H,1H2,2H3/b15-4-,27-14+ |
| InChIKey | QIDRRVCCULAGJY-FEKHHYPOSA-N |
| XLogP | 9.69 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|