C55H44N6 — CID 139376554
2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl]-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-phenyl-1,3,5-triazine (PubChem CID 139376554) has the molecular formula C55H44N6 and a molecular weight of 789.00 g/mol. Its IUPAC name is 2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl]-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl]-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 139376554 |
| Molecular Formula | C55H44N6 |
| Molecular Weight | 789.00 g/mol |
| Exact Mass | 788.36 |
| IUPAC Name | 2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6,12,12-tetramethylindeno[1,2-b]fluoren-2-yl]-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-phenyl-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C/C)c1nc(-c2ccccc2)nc(-c2ccc3c(c2)C(C)(C)c2cc4c(cc2-3)C(C)(C)c2cc(-c3nc(-c5ccccc5)nc(-c5ccccc5)n3)ccc2-4)n1 |
| InChI | InChI=1S/C55H44N6/c1-7-18-34(19-8-2)48-56-49(35-20-12-9-13-21-35)59-52(58-48)38-26-28-40-42-32-47-43(33-46(42)54(3,4)44(40)30-38)41-29-27-39(31-45(41)55(47,5)6)53-60-50(36-22-14-10-15-23-36)57-51(61-53)37-24-16-11-17-25-37/h7-33H,1H2,2-6H3/b19-8-,34-18+ |
| InChIKey | HWRSHLYYWBARRS-FFXGCZQSSA-N |
| XLogP | 13.15 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.00 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|