C21H17N3 — CID 134447786
2-[(3E)-hexa-1,3,5-trien-3-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 134447786) has the molecular formula C21H17N3 and a molecular weight of 311.39 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 134447786 |
| Molecular Formula | C21H17N3 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H17N3/c1-3-11-16(4-2)19-22-20(17-12-7-5-8-13-17)24-21(23-19)18-14-9-6-10-15-18/h3-15H,1-2H2/b16-11+ |
| InChIKey | LIXNENIZSSSTPQ-LFIBNONCSA-N |
| XLogP | 4.96 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|