C16H14ClN3 — CID 145217979
2-chloro-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazine (PubChem CID 145217979) has the molecular formula C16H14ClN3 and a molecular weight of 283.76 g/mol. Its IUPAC name is 2-chloro-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-chloro-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 145217979 |
| Molecular Formula | C16H14ClN3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-chloro-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-phenyl-1,3,5-triazine |
| SMILES | C=C/C(=C\C=C/C)c1nc(Cl)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H14ClN3/c1-3-5-9-12(4-2)14-18-15(20-16(17)19-14)13-10-7-6-8-11-13/h3-11H,2H2,1H3/b5-3-,12-9+ |
| InChIKey | KLTPPKFSTSCBNT-FNNBZGKSSA-N |
| XLogP | 4.34 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|