C17H15BrN2 — CID 130452753
5-bromo-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-phenylpyrimidine (PubChem CID 130452753) has the molecular formula C17H15BrN2 and a molecular weight of 327.23 g/mol. Its IUPAC name is 5-bromo-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-phenylpyrimidine.
| Compound Name | 5-bromo-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-phenylpyrimidine |
|---|---|
| PubChem CID | 130452753 |
| Molecular Formula | C17H15BrN2 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 5-bromo-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-phenylpyrimidine |
| SMILES | C=C/C(=C\C=C/C)c1ncc(Br)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H15BrN2/c1-3-5-9-13(4-2)17-19-12-15(18)16(20-17)14-10-7-6-8-11-14/h3-12H,2H2,1H3/b5-3-,13-9+ |
| InChIKey | PAZBOTAOJBSBJV-HZPINNGZSA-N |
| XLogP | 5.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|