C32H30N2 — CID 144969354
2-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methylphenyl]-5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine (PubChem CID 144969354) has the molecular formula C32H30N2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 2-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methylphenyl]-5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine.
| Compound Name | 2-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methylphenyl]-5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine |
|---|---|
| PubChem CID | 144969354 |
| Molecular Formula | C32H30N2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 2-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methylphenyl]-5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine |
| SMILES | C=C/C(=C\C=C/C)c1cc(C)cc(-c2nc(-c3ccccc3)c(C)c(-c3ccccc3C)n2)c1 |
| InChI | InChI=1S/C32H30N2/c1-6-8-15-25(7-2)27-19-22(3)20-28(21-27)32-33-30(26-16-10-9-11-17-26)24(5)31(34-32)29-18-13-12-14-23(29)4/h6-21H,2H2,1,3-5H3/b8-6-,25-15+ |
| InChIKey | QUNNYHUQAORISE-MWKOPTRASA-N |
| XLogP | 8.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|