C29H23BrN2 — CID 171812706
2-(3-bromophenyl)-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5,6-diphenylpyrazine (PubChem CID 171812706) has the molecular formula C29H23BrN2 and a molecular weight of 479.42 g/mol. Its IUPAC name is 2-(3-bromophenyl)-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5,6-diphenylpyrazine.
| Compound Name | 2-(3-bromophenyl)-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5,6-diphenylpyrazine |
|---|---|
| PubChem CID | 171812706 |
| Molecular Formula | C29H23BrN2 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 2-(3-bromophenyl)-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5,6-diphenylpyrazine |
| SMILES | C=C/C(=C\C=C/C)c1nc(-c2ccccc2)c(-c2ccccc2)nc1-c1cccc(Br)c1 |
| InChI | InChI=1S/C29H23BrN2/c1-3-5-13-21(4-2)26-29(24-18-12-19-25(30)20-24)32-28(23-16-10-7-11-17-23)27(31-26)22-14-8-6-9-15-22/h3-20H,2H2,1H3/b5-3-,21-13+ |
| InChIKey | WAXMSWWUSBIYQV-BWFWUWGJSA-N |
| XLogP | 8.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|