C15H11BrN4 — CID 53354729
6-(3-bromophenyl)-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 53354729) has the molecular formula C15H11BrN4 and a molecular weight of 327.19 g/mol. Its IUPAC name is 6-(3-bromophenyl)-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | 6-(3-bromophenyl)-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 53354729 |
| Molecular Formula | C15H11BrN4 |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 6-(3-bromophenyl)-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | Nc1nnc(-c2cccc(Br)c2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H11BrN4/c16-12-8-4-7-11(9-12)14-13(18-15(17)20-19-14)10-5-2-1-3-6-10/h1-9H,(H2,17,18,20) |
| InChIKey | OKGUZLSULPECHT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |