About 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine
6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 158796576) has the molecular formula C30H22F2N8
and a molecular weight of 532.56 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine.
Molecular Properties
| Compound Name | 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine |
| PubChem CID | 158796576 |
| Molecular Formula | C30H22F2N8 |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | Nc1nnc(-c2cccc(F)c2)c(-c2ccccc2)n1.Nc1nnc(-c2cccc(F)c2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/2C15H11FN4/c2*16-12-8-4-7-11(9-12)14-13(18-15(17)20-19-14)10-5-2-1-3-6-10/h2*1-9H,(H2,17,18,20) |
| InChIKey | ISXWYCRPNNPKLB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine?
The IUPAC name of 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine (CID 158796576) is 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine.
What is the SMILES notation for 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine?
The canonical SMILES for 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine is Nc1nnc(-c2cccc(F)c2)c(-c2ccccc2)n1.Nc1nnc(-c2cccc(F)c2)c(-c2ccccc2)n1.
What is the InChIKey of 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine?
The InChIKey is ISXWYCRPNNPKLB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H11FN4/c2*16-12-8-4-7-11(9-12)14-13(18-15(17)20-19-14)10-5-2-1-3-6-10/h2*1-9H,(H2,17,18,20).
What are the key properties of 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine?
6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine has a molecular weight of 532.56 g/mol, XLogP of 5.85, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine is sourced from PubChem (CID 158796576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).