C30H22F2N8 — CID 158796576
6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 158796576) has the molecular formula C30H22F2N8 and a molecular weight of 532.56 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 158796576 |
| Molecular Formula | C30H22F2N8 |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 6-(3-fluorophenyl)-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | Nc1nnc(-c2cccc(F)c2)c(-c2ccccc2)n1.Nc1nnc(-c2cccc(F)c2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/2C15H11FN4/c2*16-12-8-4-7-11(9-12)14-13(18-15(17)20-19-14)10-5-2-1-3-6-10/h2*1-9H,(H2,17,18,20) |
| InChIKey | ISXWYCRPNNPKLB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 129.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |