C16H14N4O2S — CID 174665322
[3-(3-amino-5-phenyl-1,2,4-triazin-6-yl)phenyl]methanesulfinic acid (PubChem CID 174665322) has the molecular formula C16H14N4O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is [3-(3-amino-5-phenyl-1,2,4-triazin-6-yl)phenyl]methanesulfinic acid.
| Compound Name | [3-(3-amino-5-phenyl-1,2,4-triazin-6-yl)phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174665322 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | [3-(3-amino-5-phenyl-1,2,4-triazin-6-yl)phenyl]methanesulfinic acid |
| SMILES | Nc1nnc(-c2cccc(CS(=O)O)c2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H14N4O2S/c17-16-18-14(12-6-2-1-3-7-12)15(19-20-16)13-8-4-5-11(9-13)10-23(21)22/h1-9H,10H2,(H,21,22)(H2,17,18,20) |
| InChIKey | AANBYNVWRBHUMW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|