C10H9NO2S2 — CID 174709475
[3-(1,3-thiazol-5-yl)phenyl]methanesulfinic acid (PubChem CID 174709475) has the molecular formula C10H9NO2S2 and a molecular weight of 239.32 g/mol. Its IUPAC name is [3-(1,3-thiazol-5-yl)phenyl]methanesulfinic acid.
| Compound Name | [3-(1,3-thiazol-5-yl)phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174709475 |
| Molecular Formula | C10H9NO2S2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | [3-(1,3-thiazol-5-yl)phenyl]methanesulfinic acid |
| SMILES | O=S(O)Cc1cccc(-c2cncs2)c1 |
| InChI | InChI=1S/C10H9NO2S2/c12-15(13)6-8-2-1-3-9(4-8)10-5-11-7-14-10/h1-5,7H,6H2,(H,12,13) |
| InChIKey | MEUDBJIWBJGWDD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|