C13H19NS — CID 143177201
ethane;5-phenyl-1,3-thiazole (PubChem CID 143177201) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is ethane;5-phenyl-1,3-thiazole.
| Compound Name | ethane;5-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 143177201 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | ethane;5-phenyl-1,3-thiazole |
| SMILES | CC.CC.c1ccc(-c2cncs2)cc1 |
| InChI | InChI=1S/C9H7NS.2C2H6/c1-2-4-8(5-3-1)9-6-10-7-11-9;2*1-2/h1-7H;2*1-2H3 |
| InChIKey | HVLFAAPUSRUGNG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |