C36H22N4S2 — CID 121297776
5-[6-[2-phenyl-10-[6-(1,3-thiazol-5-yl)-2-pyridinyl]anthracen-9-yl]-2-pyridinyl]-1,3-thiazole (PubChem CID 121297776) has the molecular formula C36H22N4S2 and a molecular weight of 574.73 g/mol. Its IUPAC name is 5-[6-[2-phenyl-10-[6-(1,3-thiazol-5-yl)-2-pyridinyl]anthracen-9-yl]-2-pyridinyl]-1,3-thiazole.
| Compound Name | 5-[6-[2-phenyl-10-[6-(1,3-thiazol-5-yl)-2-pyridinyl]anthracen-9-yl]-2-pyridinyl]-1,3-thiazole |
|---|---|
| PubChem CID | 121297776 |
| Molecular Formula | C36H22N4S2 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 5-[6-[2-phenyl-10-[6-(1,3-thiazol-5-yl)-2-pyridinyl]anthracen-9-yl]-2-pyridinyl]-1,3-thiazole |
| SMILES | c1ccc(-c2ccc3c(-c4cccc(-c5cncs5)n4)c4ccccc4c(-c4cccc(-c5cncs5)n4)c3c2)cc1 |
| InChI | InChI=1S/C36H22N4S2/c1-2-8-23(9-3-1)24-16-17-27-28(18-24)36(32-15-7-13-30(40-32)34-20-38-22-42-34)26-11-5-4-10-25(26)35(27)31-14-6-12-29(39-31)33-19-37-21-41-33/h1-22H |
| InChIKey | HKNLZYWFCPZZIR-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|