C42H28N4S2 — CID 163892084
5-[5-[2-(4-phenylphenyl)-10-[5-(1,3-thiazol-5-yl)-1,2-dihydropyridin-3-yl]anthracen-9-yl]-3-pyridinyl]-1,3-thiazole (PubChem CID 163892084) has the molecular formula C42H28N4S2 and a molecular weight of 652.85 g/mol. Its IUPAC name is 5-[5-[2-(4-phenylphenyl)-10-[5-(1,3-thiazol-5-yl)-1,2-dihydropyridin-3-yl]anthracen-9-yl]-3-pyridinyl]-1,3-thiazole.
| Compound Name | 5-[5-[2-(4-phenylphenyl)-10-[5-(1,3-thiazol-5-yl)-1,2-dihydropyridin-3-yl]anthracen-9-yl]-3-pyridinyl]-1,3-thiazole |
|---|---|
| PubChem CID | 163892084 |
| Molecular Formula | C42H28N4S2 |
| Molecular Weight | 652.85 g/mol |
| Exact Mass | 652.18 |
| IUPAC Name | 5-[5-[2-(4-phenylphenyl)-10-[5-(1,3-thiazol-5-yl)-1,2-dihydropyridin-3-yl]anthracen-9-yl]-3-pyridinyl]-1,3-thiazole |
| SMILES | C1=C(c2cncs2)C=C(c2c3ccccc3c(-c3cncc(-c4cncs4)c3)c3cc(-c4ccc(-c5ccccc5)cc4)ccc23)CN1 |
| InChI | InChI=1S/C42H28N4S2/c1-2-6-27(7-3-1)28-10-12-29(13-11-28)30-14-15-37-38(18-30)42(34-17-32(20-44-22-34)40-24-46-26-48-40)36-9-5-4-8-35(36)41(37)33-16-31(19-43-21-33)39-23-45-25-47-39/h1-20,22-26,43H,21H2 |
| InChIKey | QCKAFRMJSAPIMB-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.85 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|