C40H34N4O2 — CID 135249853
2-[6-[10-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pyridinyl]-2-phenylanthracen-9-yl]-2-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 135249853) has the molecular formula C40H34N4O2 and a molecular weight of 602.74 g/mol. Its IUPAC name is 2-[6-[10-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pyridinyl]-2-phenylanthracen-9-yl]-2-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[6-[10-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pyridinyl]-2-phenylanthracen-9-yl]-2-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 135249853 |
| Molecular Formula | C40H34N4O2 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 2-[6-[10-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pyridinyl]-2-phenylanthracen-9-yl]-2-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2cccc(-c3c4ccccc4c(-c4cccc(C5=NC(C)(C)CO5)n4)c4cc(-c5ccccc5)ccc34)n2)=N1 |
| InChI | InChI=1S/C40H34N4O2/c1-39(2)23-45-37(43-39)33-18-10-16-31(41-33)35-27-14-8-9-15-28(27)36(30-22-26(20-21-29(30)35)25-12-6-5-7-13-25)32-17-11-19-34(42-32)38-44-40(3,4)24-46-38/h5-22H,23-24H2,1-4H3 |
| InChIKey | SCPQWQBMDRYXEY-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|