C40H34N2O2 — CID 135250470
2-[4-[7-[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]benzo[a]anthracen-12-yl]phenyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 135250470) has the molecular formula C40H34N2O2 and a molecular weight of 574.72 g/mol. Its IUPAC name is 2-[4-[7-[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]benzo[a]anthracen-12-yl]phenyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[4-[7-[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]benzo[a]anthracen-12-yl]phenyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 135250470 |
| Molecular Formula | C40H34N2O2 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 2-[4-[7-[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]benzo[a]anthracen-12-yl]phenyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2ccc(-c3c4ccccc4c(-c4ccc(C5=NC(C)(C)CO5)cc4)c4c3ccc3ccccc34)cc2)=N1 |
| InChI | InChI=1S/C40H34N2O2/c1-39(2)23-43-37(41-39)28-17-13-26(14-18-28)34-31-11-7-8-12-32(31)35(36-30-10-6-5-9-25(30)21-22-33(34)36)27-15-19-29(20-16-27)38-42-40(3,4)24-44-38/h5-22H,23-24H2,1-4H3 |
| InChIKey | GOJYSEDUZOFGNY-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|