C17H19NO — CID 10848489
2-(1-ethylnaphthalen-2-yl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 10848489) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-(1-ethylnaphthalen-2-yl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-(1-ethylnaphthalen-2-yl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 10848489 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-(1-ethylnaphthalen-2-yl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CCc1c(C2=NC(C)(C)CO2)ccc2ccccc12 |
| InChI | InChI=1S/C17H19NO/c1-4-13-14-8-6-5-7-12(14)9-10-15(13)16-18-17(2,3)11-19-16/h5-10H,4,11H2,1-3H3 |
| InChIKey | MSGHAGXRBOLFIS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |