C11H14N2O — CID 10583839
2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)aniline (PubChem CID 10583839) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)aniline.
| Compound Name | 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)aniline |
|---|---|
| PubChem CID | 10583839 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)aniline |
| SMILES | CC1(C)COC(c2ccccc2N)=N1 |
| InChI | InChI=1S/C11H14N2O/c1-11(2)7-14-10(13-11)8-5-3-4-6-9(8)12/h3-6H,7,12H2,1-2H3 |
| InChIKey | QDZXKPVTJDXUQU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|