C14H18BrNO3 — CID 23043950
2-[2-(bromomethyl)-3,4-dimethoxyphenyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 23043950) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3,4-dimethoxyphenyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[2-(bromomethyl)-3,4-dimethoxyphenyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 23043950 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 2-[2-(bromomethyl)-3,4-dimethoxyphenyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | COc1ccc(C2=NC(C)(C)CO2)c(CBr)c1OC |
| InChI | InChI=1S/C14H18BrNO3/c1-14(2)8-19-13(16-14)9-5-6-11(17-3)12(18-4)10(9)7-15/h5-6H,7-8H2,1-4H3 |
| InChIKey | QAFQDKJERIEPSF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|