C22H21NO2 — CID 134114249
[4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-naphthalen-2-ylmethanol (PubChem CID 134114249) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-naphthalen-2-ylmethanol.
| Compound Name | [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-naphthalen-2-ylmethanol |
|---|---|
| PubChem CID | 134114249 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | [4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-naphthalen-2-ylmethanol |
| SMILES | CC1(C)COC(c2ccc(C(O)c3ccc4ccccc4c3)cc2)=N1 |
| InChI | InChI=1S/C22H21NO2/c1-22(2)14-25-21(23-22)17-10-8-16(9-11-17)20(24)19-12-7-15-5-3-4-6-18(15)13-19/h3-13,20,24H,14H2,1-2H3 |
| InChIKey | LHOBCWOMOIZNRX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |